C13H11N3O2S2 — CID 1328612
3-amino-5-(1,7-dimethyl-2-oxoindol-3-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 1328612) has the molecular formula C13H11N3O2S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-amino-5-(1,7-dimethyl-2-oxoindol-3-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-amino-5-(1,7-dimethyl-2-oxoindol-3-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1328612 |
| Molecular Formula | C13H11N3O2S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 3-amino-5-(1,7-dimethyl-2-oxoindol-3-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1cccc2c1N(C)C(=O)C2=C1SC(=S)N(N)C1=O |
| InChI | InChI=1S/C13H11N3O2S2/c1-6-4-3-5-7-8(11(17)15(2)9(6)7)10-12(18)16(14)13(19)20-10/h3-5H,14H2,1-2H3 |
| InChIKey | OTVHZNYTJZWFCN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|