C21H20Cl2N4OS — CID 1328792
2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenylethyl)acetamide (PubChem CID 1328792) has the molecular formula C21H20Cl2N4OS and a molecular weight of 447.39 g/mol. Its IUPAC name is 2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 1328792 |
| Molecular Formula | C21H20Cl2N4OS |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenylethyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)NCCc2ccccc2)nnc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H20Cl2N4OS/c1-2-12-27-20(17-9-8-16(22)13-18(17)23)25-26-21(27)29-14-19(28)24-11-10-15-6-4-3-5-7-15/h2-9,13H,1,10-12,14H2,(H,24,28) |
| InChIKey | QJJHWDXTBFOIJP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|