C5H9ClIN3 — CID 132891317
3-chloro-1,4,5-trimethyl-1,2,4-triazol-4-ium iodide (PubChem CID 132891317) has the molecular formula C5H9ClIN3 and a molecular weight of 273.50 g/mol. Its IUPAC name is 3-chloro-1,4,5-trimethyl-1,2,4-triazol-4-ium iodide.
| Compound Name | 3-chloro-1,4,5-trimethyl-1,2,4-triazol-4-ium iodide |
|---|---|
| PubChem CID | 132891317 |
| Molecular Formula | C5H9ClIN3 |
| Molecular Weight | 273.50 g/mol |
| Exact Mass | 272.95 |
| IUPAC Name | 3-chloro-1,4,5-trimethyl-1,2,4-triazol-4-ium iodide |
| SMILES | Cc1n(C)nc(Cl)[n+]1C.[I-] |
| InChI | InChI=1S/C5H9ClN3.HI/c1-4-8(2)5(6)7-9(4)3;/h1-3H3;1H/q+1;/p-1 |
| InChIKey | XCEUPBIXDHJUOD-UHFFFAOYSA-M |
| XLogP | -2.79 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.50 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|