About 4-(4-chlorophenyl)-N,N-dimethyl-1H-pyrazol-5-amine
4-(4-chlorophenyl)-N,N-dimethyl-1H-pyrazol-5-amine (PubChem CID 13290234) has the molecular formula C11H12ClN3
and a molecular weight of 221.69 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N,N-dimethyl-1H-pyrazol-5-amine.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-N,N-dimethyl-1H-pyrazol-5-amine |
| PubChem CID | 13290234 |
| Molecular Formula | C11H12ClN3 |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 4-(4-chlorophenyl)-N,N-dimethyl-1H-pyrazol-5-amine |
| SMILES | CN(C)c1[nH]ncc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H12ClN3/c1-15(2)11-10(7-13-14-11)8-3-5-9(12)6-4-8/h3-7H,1-2H3,(H,13,14) |
| InChIKey | PQJWHUKJGPERDG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-chlorophenyl)-N,N-dimethyl-1H-pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-N,N-dimethyl-1H-pyrazol-5-amine?
The IUPAC name of 4-(4-chlorophenyl)-N,N-dimethyl-1H-pyrazol-5-amine (CID 13290234) is 4-(4-chlorophenyl)-N,N-dimethyl-1H-pyrazol-5-amine.
What is the SMILES notation for 4-(4-chlorophenyl)-N,N-dimethyl-1H-pyrazol-5-amine?
The canonical SMILES for 4-(4-chlorophenyl)-N,N-dimethyl-1H-pyrazol-5-amine is CN(C)c1[nH]ncc1-c1ccc(Cl)cc1.
What is the InChIKey of 4-(4-chlorophenyl)-N,N-dimethyl-1H-pyrazol-5-amine?
The InChIKey is PQJWHUKJGPERDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN3/c1-15(2)11-10(7-13-14-11)8-3-5-9(12)6-4-8/h3-7H,1-2H3,(H,13,14).
What are the key properties of 4-(4-chlorophenyl)-N,N-dimethyl-1H-pyrazol-5-amine?
4-(4-chlorophenyl)-N,N-dimethyl-1H-pyrazol-5-amine has a molecular weight of 221.69 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-N,N-dimethyl-1H-pyrazol-5-amine is sourced from PubChem (CID 13290234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).