C19H14N2O6S — CID 13290575
2-methyl-1,1,4-trioxo-N-(4-oxochromen-3-yl)-3H-1lambda6,2-benzothiazine-3-carboxamide (PubChem CID 13290575) has the molecular formula C19H14N2O6S and a molecular weight of 398.40 g/mol. Its IUPAC name is 2-methyl-1,1,4-trioxo-N-(4-oxochromen-3-yl)-3H-1lambda6,2-benzothiazine-3-carboxamide.
| Compound Name | 2-methyl-1,1,4-trioxo-N-(4-oxochromen-3-yl)-3H-1lambda6,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 13290575 |
| Molecular Formula | C19H14N2O6S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 2-methyl-1,1,4-trioxo-N-(4-oxochromen-3-yl)-3H-1lambda6,2-benzothiazine-3-carboxamide |
| SMILES | CN1C(C(=O)Nc2coc3ccccc3c2=O)C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C19H14N2O6S/c1-21-16(18(23)12-7-3-5-9-15(12)28(21,25)26)19(24)20-13-10-27-14-8-4-2-6-11(14)17(13)22/h2-10,16H,1H3,(H,20,24) |
| InChIKey | HQIPBOLXJVYBNB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|