About 4-(3-fluorophenyl)-1,3-dihydroimidazole-2-thione
4-(3-fluorophenyl)-1,3-dihydroimidazole-2-thione (PubChem CID 13290693) has the molecular formula C9H7FN2S
and a molecular weight of 194.23 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-1,3-dihydroimidazole-2-thione.
Molecular Properties
| Compound Name | 4-(3-fluorophenyl)-1,3-dihydroimidazole-2-thione |
| PubChem CID | 13290693 |
| Molecular Formula | C9H7FN2S |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 4-(3-fluorophenyl)-1,3-dihydroimidazole-2-thione |
| SMILES | Fc1cccc(-c2c[nH]c(=S)[nH]2)c1 |
| InChI | InChI=1S/C9H7FN2S/c10-7-3-1-2-6(4-7)8-5-11-9(13)12-8/h1-5H,(H2,11,12,13) |
| InChIKey | YWOCXBUWMQILPA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-fluorophenyl)-1,3-dihydroimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-fluorophenyl)-1,3-dihydroimidazole-2-thione?
The IUPAC name of 4-(3-fluorophenyl)-1,3-dihydroimidazole-2-thione (CID 13290693) is 4-(3-fluorophenyl)-1,3-dihydroimidazole-2-thione.
What is the SMILES notation for 4-(3-fluorophenyl)-1,3-dihydroimidazole-2-thione?
The canonical SMILES for 4-(3-fluorophenyl)-1,3-dihydroimidazole-2-thione is Fc1cccc(-c2c[nH]c(=S)[nH]2)c1.
What is the InChIKey of 4-(3-fluorophenyl)-1,3-dihydroimidazole-2-thione?
The InChIKey is YWOCXBUWMQILPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FN2S/c10-7-3-1-2-6(4-7)8-5-11-9(13)12-8/h1-5H,(H2,11,12,13).
What are the key properties of 4-(3-fluorophenyl)-1,3-dihydroimidazole-2-thione?
4-(3-fluorophenyl)-1,3-dihydroimidazole-2-thione has a molecular weight of 194.23 g/mol, XLogP of 2.88, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-fluorophenyl)-1,3-dihydroimidazole-2-thione is sourced from PubChem (CID 13290693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).