About 1-phenylmethoxy-2,3-di(propan-2-yl)guanidine;hydrochloride
1-phenylmethoxy-2,3-di(propan-2-yl)guanidine;hydrochloride (PubChem CID 13291) has the molecular formula C14H24ClN3O
and a molecular weight of 285.82 g/mol. Its IUPAC name is 1-phenylmethoxy-2,3-di(propan-2-yl)guanidine;hydrochloride.
Molecular Properties
| Compound Name | 1-phenylmethoxy-2,3-di(propan-2-yl)guanidine;hydrochloride |
| PubChem CID | 13291 |
| Molecular Formula | C14H24ClN3O |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 1-phenylmethoxy-2,3-di(propan-2-yl)guanidine;hydrochloride |
| SMILES | CC(C)/N=C(/NOCc1ccccc1)NC(C)C.Cl |
| InChI | InChI=1S/C14H23N3O.ClH/c1-11(2)15-14(16-12(3)4)17-18-10-13-8-6-5-7-9-13;/h5-9,11-12H,10H2,1-4H3,(H2,15,16,17);1H |
| InChIKey | SQWVAGNZXNFVHS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylmethoxy-2,3-di(propan-2-yl)guanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylmethoxy-2,3-di(propan-2-yl)guanidine;hydrochloride?
The IUPAC name of 1-phenylmethoxy-2,3-di(propan-2-yl)guanidine;hydrochloride (CID 13291) is 1-phenylmethoxy-2,3-di(propan-2-yl)guanidine;hydrochloride.
What is the SMILES notation for 1-phenylmethoxy-2,3-di(propan-2-yl)guanidine;hydrochloride?
The canonical SMILES for 1-phenylmethoxy-2,3-di(propan-2-yl)guanidine;hydrochloride is CC(C)/N=C(/NOCc1ccccc1)NC(C)C.Cl.
What is the InChIKey of 1-phenylmethoxy-2,3-di(propan-2-yl)guanidine;hydrochloride?
The InChIKey is SQWVAGNZXNFVHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O.ClH/c1-11(2)15-14(16-12(3)4)17-18-10-13-8-6-5-7-9-13;/h5-9,11-12H,10H2,1-4H3,(H2,15,16,17);1H.
What are the key properties of 1-phenylmethoxy-2,3-di(propan-2-yl)guanidine;hydrochloride?
1-phenylmethoxy-2,3-di(propan-2-yl)guanidine;hydrochloride has a molecular weight of 285.82 g/mol, XLogP of 2.89, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylmethoxy-2,3-di(propan-2-yl)guanidine;hydrochloride is sourced from PubChem (CID 13291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).