methyl 4-bromo-5-nitrothiophene-2-carboxylate

C6H4BrNO4S — CID 13291027

IUPACmethyl 4-bromo-5-nitrothiophene-2-carboxylate
SMILESCOC(=O)c1cc(Br)c([N+](=O)[O-])s1
InChIInChI=1S/C6H4BrNO4S/c1-12-6(9)4-2-3(7)5(13-4)8(10)11/h2H,1H3
InChIKeyHGQUBXGVOBVNJN-UHFFFAOYSA-N
MW266.07 g/mol
LogP2.21
Rot. Bonds2

About methyl 4-bromo-5-nitrothiophene-2-carboxylate

methyl 4-bromo-5-nitrothiophene-2-carboxylate (PubChem CID 13291027) has the molecular formula C6H4BrNO4S and a molecular weight of 266.07 g/mol. Its IUPAC name is methyl 4-bromo-5-nitrothiophene-2-carboxylate.

Molecular Properties

Compound Namemethyl 4-bromo-5-nitrothiophene-2-carboxylate
PubChem CID13291027
Molecular FormulaC6H4BrNO4S
Molecular Weight266.07 g/mol
Exact Mass264.90
IUPAC Namemethyl 4-bromo-5-nitrothiophene-2-carboxylate
SMILESCOC(=O)c1cc(Br)c([N+](=O)[O-])s1
InChIInChI=1S/C6H4BrNO4S/c1-12-6(9)4-2-3(7)5(13-4)8(10)11/h2H,1H3
InChIKeyHGQUBXGVOBVNJN-UHFFFAOYSA-N
XLogP2.21
TPSA69.44 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.07
LogP ≤ 52.21
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 4-bromo-5-nitrothiophene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-bromo-5-nitrothiophene-2-carboxylate?
The IUPAC name of methyl 4-bromo-5-nitrothiophene-2-carboxylate (CID 13291027) is methyl 4-bromo-5-nitrothiophene-2-carboxylate.
What is the SMILES notation for methyl 4-bromo-5-nitrothiophene-2-carboxylate?
The canonical SMILES for methyl 4-bromo-5-nitrothiophene-2-carboxylate is COC(=O)c1cc(Br)c([N+](=O)[O-])s1.
What is the InChIKey of methyl 4-bromo-5-nitrothiophene-2-carboxylate?
The InChIKey is HGQUBXGVOBVNJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrNO4S/c1-12-6(9)4-2-3(7)5(13-4)8(10)11/h2H,1H3.
What are the key properties of methyl 4-bromo-5-nitrothiophene-2-carboxylate?
methyl 4-bromo-5-nitrothiophene-2-carboxylate has a molecular weight of 266.07 g/mol, XLogP of 2.21, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-bromo-5-nitrothiophene-2-carboxylate is sourced from PubChem (CID 13291027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).