C36H36S — CID 132915333
[(1S,2R,3R)-2-methyl-2-[(1R,2R,3R)-2-methyl-2-[(1R,2S)-1-methyl-2-phenylcyclopropyl]-3-phenylcyclopropyl]-3-phenylcyclopropyl]sulfanylbenzene (PubChem CID 132915333) has the molecular formula C36H36S and a molecular weight of 500.75 g/mol. Its IUPAC name is [(1S,2R,3R)-2-methyl-2-[(1R,2R,3R)-2-methyl-2-[(1R,2S)-1-methyl-2-phenylcyclopropyl]-3-phenylcyclopropyl]-3-phenylcyclopropyl]sulfanylbenzene.
| Compound Name | [(1S,2R,3R)-2-methyl-2-[(1R,2R,3R)-2-methyl-2-[(1R,2S)-1-methyl-2-phenylcyclopropyl]-3-phenylcyclopropyl]-3-phenylcyclopropyl]sulfanylbenzene |
|---|---|
| PubChem CID | 132915333 |
| Molecular Formula | C36H36S |
| Molecular Weight | 500.75 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | [(1S,2R,3R)-2-methyl-2-[(1R,2R,3R)-2-methyl-2-[(1R,2S)-1-methyl-2-phenylcyclopropyl]-3-phenylcyclopropyl]-3-phenylcyclopropyl]sulfanylbenzene |
| SMILES | C[C@]1([C@@H]2[C@H](c3ccccc3)[C@@]2(C)[C@]2(C)C[C@H]2c2ccccc2)[C@@H](Sc2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C36H36S/c1-34(24-29(34)25-16-8-4-9-17-25)36(3)30(26-18-10-5-11-19-26)32(36)35(2)31(27-20-12-6-13-21-27)33(35)37-28-22-14-7-15-23-28/h4-23,29-33H,24H2,1-3H3/t29-,30-,31-,32-,33-,34+,35-,36+/m0/s1 |
| InChIKey | KEWYTQDXZHKUAD-FFPINXDDSA-N |
| XLogP | 9.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.75 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |