C21H21N7O — CID 132915759
8-butyl-10-(3-methylphenyl)-2,3,4,5,8,10,12-heptazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,11,13,15-hexaen-9-one (PubChem CID 132915759) has the molecular formula C21H21N7O and a molecular weight of 387.45 g/mol. Its IUPAC name is 8-butyl-10-(3-methylphenyl)-2,3,4,5,8,10,12-heptazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,11,13,15-hexaen-9-one.
| Compound Name | 8-butyl-10-(3-methylphenyl)-2,3,4,5,8,10,12-heptazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,11,13,15-hexaen-9-one |
|---|---|
| PubChem CID | 132915759 |
| Molecular Formula | C21H21N7O |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 8-butyl-10-(3-methylphenyl)-2,3,4,5,8,10,12-heptazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,11,13,15-hexaen-9-one |
| SMILES | CCCCN1C(=O)N(c2cccc(C)c2)C2=Nc3ccccc3-n3nnnc3C21 |
| InChI | InChI=1S/C21H21N7O/c1-3-4-12-26-18-19(27(21(26)29)15-9-7-8-14(2)13-15)22-16-10-5-6-11-17(16)28-20(18)23-24-25-28/h5-11,13,18H,3-4,12H2,1-2H3 |
| InChIKey | AYEMKAABISRSEU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 79.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |