C19H34O4 — CID 13291619
methyl (10E,12E)-9-hydroperoxyoctadeca-10,12-dienoate (PubChem CID 13291619) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is methyl (10E,12E)-9-hydroperoxyoctadeca-10,12-dienoate.
| Compound Name | methyl (10E,12E)-9-hydroperoxyoctadeca-10,12-dienoate |
|---|---|
| PubChem CID | 13291619 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | methyl (10E,12E)-9-hydroperoxyoctadeca-10,12-dienoate |
| SMILES | CCCCC/C=C/C=C/C(CCCCCCCC(=O)OC)OO |
| InChI | InChI=1S/C19H34O4/c1-3-4-5-6-7-9-12-15-18(23-21)16-13-10-8-11-14-17-19(20)22-2/h7,9,12,15,18,21H,3-6,8,10-11,13-14,16-17H2,1-2H3/b9-7+,15-12+ |
| InChIKey | NAIVAZYIMZYEHW-KDFHGORWSA-N |
| XLogP | 5.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|