C14H24N2OSi — CID 132916206
(2R,6R)-2,9,9-trimethyl-3-trimethylsilyl-4,5-diazatricyclo[6.1.1.02,6]dec-3-en-7-one (PubChem CID 132916206) has the molecular formula C14H24N2OSi and a molecular weight of 264.44 g/mol. Its IUPAC name is (2R,6R)-2,9,9-trimethyl-3-trimethylsilyl-4,5-diazatricyclo[6.1.1.02,6]dec-3-en-7-one.
| Compound Name | (2R,6R)-2,9,9-trimethyl-3-trimethylsilyl-4,5-diazatricyclo[6.1.1.02,6]dec-3-en-7-one |
|---|---|
| PubChem CID | 132916206 |
| Molecular Formula | C14H24N2OSi |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (2R,6R)-2,9,9-trimethyl-3-trimethylsilyl-4,5-diazatricyclo[6.1.1.02,6]dec-3-en-7-one |
| SMILES | CC1(C)C2CC1[C@@]1(C)C([Si](C)(C)C)=NN[C@H]1C2=O |
| InChI | InChI=1S/C14H24N2OSi/c1-13(2)8-7-9(13)14(3)11(10(8)17)15-16-12(14)18(4,5)6/h8-9,11,15H,7H2,1-6H3/t8?,9?,11-,14+/m0/s1 |
| InChIKey | UWVQFBNVURICMO-HDOXWXFPSA-N |
| XLogP | 2.44 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|