C15H19Cl2NO6 — CID 132916473
(4S,5R,6S)-2-(3,4-dichlorophenyl)-6-[(1S)-1,2-dihydroxyethyl]-N-ethyl-5-hydroxy-1,3-dioxane-4-carboxamide (PubChem CID 132916473) has the molecular formula C15H19Cl2NO6 and a molecular weight of 380.22 g/mol. Its IUPAC name is (4S,5R,6S)-2-(3,4-dichlorophenyl)-6-[(1S)-1,2-dihydroxyethyl]-N-ethyl-5-hydroxy-1,3-dioxane-4-carboxamide.
| Compound Name | (4S,5R,6S)-2-(3,4-dichlorophenyl)-6-[(1S)-1,2-dihydroxyethyl]-N-ethyl-5-hydroxy-1,3-dioxane-4-carboxamide |
|---|---|
| PubChem CID | 132916473 |
| Molecular Formula | C15H19Cl2NO6 |
| Molecular Weight | 380.22 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | (4S,5R,6S)-2-(3,4-dichlorophenyl)-6-[(1S)-1,2-dihydroxyethyl]-N-ethyl-5-hydroxy-1,3-dioxane-4-carboxamide |
| SMILES | CCNC(=O)[C@H]1OC(c2ccc(Cl)c(Cl)c2)O[C@@H]([C@@H](O)CO)[C@H]1O |
| InChI | InChI=1S/C15H19Cl2NO6/c1-2-18-14(22)13-11(21)12(10(20)6-19)23-15(24-13)7-3-4-8(16)9(17)5-7/h3-5,10-13,15,19-21H,2,6H2,1H3,(H,18,22)/t10-,11+,12-,13-,15?/m0/s1 |
| InChIKey | MSHZEVIYJJZVAU-JIQJMPTESA-N |
| XLogP | 0.63 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |