About 2-adamantylmethanol
2-adamantylmethanol (PubChem CID 13291731) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is 2-adamantylmethanol.
Molecular Properties
| Compound Name | 2-adamantylmethanol |
| PubChem CID | 13291731 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 2-adamantylmethanol |
| SMILES | OCC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C11H18O/c12-6-11-9-2-7-1-8(4-9)5-10(11)3-7/h7-12H,1-6H2 |
| InChIKey | DBUJFSXRBAWWSM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-adamantylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-adamantylmethanol?
The IUPAC name of 2-adamantylmethanol (CID 13291731) is 2-adamantylmethanol.
What is the SMILES notation for 2-adamantylmethanol?
The canonical SMILES for 2-adamantylmethanol is OCC1C2CC3CC(C2)CC1C3.
What is the InChIKey of 2-adamantylmethanol?
The InChIKey is DBUJFSXRBAWWSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O/c12-6-11-9-2-7-1-8(4-9)5-10(11)3-7/h7-12H,1-6H2.
What are the key properties of 2-adamantylmethanol?
2-adamantylmethanol has a molecular weight of 166.26 g/mol, XLogP of 2.05, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-adamantylmethanol is sourced from PubChem (CID 13291731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).