C22H27NO3 — CID 132917386
(1S,2R,3R,13R,14S,17R,18S)-17-ethynyl-2,18-dimethyl-7-oxa-6-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-3,17-diol (PubChem CID 132917386) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is (1S,2R,3R,13R,14S,17R,18S)-17-ethynyl-2,18-dimethyl-7-oxa-6-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-3,17-diol.
| Compound Name | (1S,2R,3R,13R,14S,17R,18S)-17-ethynyl-2,18-dimethyl-7-oxa-6-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-3,17-diol |
|---|---|
| PubChem CID | 132917386 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (1S,2R,3R,13R,14S,17R,18S)-17-ethynyl-2,18-dimethyl-7-oxa-6-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-3,17-diol |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=Cc5oncc5[C@H](O)[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C22H27NO3/c1-4-22(25)10-8-16-14-6-5-13-11-18-15(12-23-26-18)19(24)21(13,3)17(14)7-9-20(16,22)2/h1,11-12,14,16-17,19,24-25H,5-10H2,2-3H3/t14-,16-,17-,19-,20-,21-,22-/m0/s1 |
| InChIKey | QKORMXMLTVYGCJ-HNLKGORASA-N |
| XLogP | 3.71 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|