C42H36N6 — CID 132917483
4-[3,5-bis[4-(pyridin-2-ylmethylamino)phenyl]phenyl]-N-(pyridin-2-ylmethyl)aniline (PubChem CID 132917483) has the molecular formula C42H36N6 and a molecular weight of 624.79 g/mol. Its IUPAC name is 4-[3,5-bis[4-(pyridin-2-ylmethylamino)phenyl]phenyl]-N-(pyridin-2-ylmethyl)aniline.
| Compound Name | 4-[3,5-bis[4-(pyridin-2-ylmethylamino)phenyl]phenyl]-N-(pyridin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 132917483 |
| Molecular Formula | C42H36N6 |
| Molecular Weight | 624.79 g/mol |
| Exact Mass | 624.30 |
| IUPAC Name | 4-[3,5-bis[4-(pyridin-2-ylmethylamino)phenyl]phenyl]-N-(pyridin-2-ylmethyl)aniline |
| SMILES | c1ccc(CNc2ccc(-c3cc(-c4ccc(NCc5ccccn5)cc4)cc(-c4ccc(NCc5ccccn5)cc4)c3)cc2)nc1 |
| InChI | InChI=1S/C42H36N6/c1-4-22-43-40(7-1)28-46-37-16-10-31(11-17-37)34-25-35(32-12-18-38(19-13-32)47-29-41-8-2-5-23-44-41)27-36(26-34)33-14-20-39(21-15-33)48-30-42-9-3-6-24-45-42/h1-27,46-48H,28-30H2 |
| InChIKey | YESOPOIGXGOSEN-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.79 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |