C33H21N9 — CID 132917597
2,4,6-tris(3-pyrimidin-5-ylphenyl)-1,3,5-triazine (PubChem CID 132917597) has the molecular formula C33H21N9 and a molecular weight of 543.59 g/mol. Its IUPAC name is 2,4,6-tris(3-pyrimidin-5-ylphenyl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(3-pyrimidin-5-ylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 132917597 |
| Molecular Formula | C33H21N9 |
| Molecular Weight | 543.59 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | 2,4,6-tris(3-pyrimidin-5-ylphenyl)-1,3,5-triazine |
| SMILES | c1cc(-c2cncnc2)cc(-c2nc(-c3cccc(-c4cncnc4)c3)nc(-c3cccc(-c4cncnc4)c3)n2)c1 |
| InChI | InChI=1S/C33H21N9/c1-4-22(28-13-34-19-35-14-28)10-25(7-1)31-40-32(26-8-2-5-23(11-26)29-15-36-20-37-16-29)42-33(41-31)27-9-3-6-24(12-27)30-17-38-21-39-18-30/h1-21H |
| InChIKey | VTJFHMXDKGXZFC-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.59 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |