About 1-(3-bromo-[1,2]selenazolo[2,3-a]pyridin-8-ium-2-yl)cyclohexan-1-ol
1-(3-bromo-[1,2]selenazolo[2,3-a]pyridin-8-ium-2-yl)cyclohexan-1-ol (PubChem CID 132917684) has the molecular formula C13H15BrNOSe+
and a molecular weight of 360.13 g/mol. Its IUPAC name is 1-(3-bromo-[1,2]selenazolo[2,3-a]pyridin-8-ium-2-yl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-(3-bromo-[1,2]selenazolo[2,3-a]pyridin-8-ium-2-yl)cyclohexan-1-ol |
| PubChem CID | 132917684 |
| Molecular Formula | C13H15BrNOSe+ |
| Molecular Weight | 360.13 g/mol |
| Exact Mass | 359.95 |
| IUPAC Name | 1-(3-bromo-[1,2]selenazolo[2,3-a]pyridin-8-ium-2-yl)cyclohexan-1-ol |
| SMILES | OC1(c2[se][n+]3ccccc3c2Br)CCCCC1 |
| InChI | InChI=1S/C13H15BrNOSe/c14-11-10-6-2-5-9-15(10)17-12(11)13(16)7-3-1-4-8-13/h2,5-6,9,16H,1,3-4,7-8H2/q+1 |
| InChIKey | PCPATGCDBXEVGM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 24.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.13 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-bromo-[1,2]selenazolo[2,3-a]pyridin-8-ium-2-yl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromo-[1,2]selenazolo[2,3-a]pyridin-8-ium-2-yl)cyclohexan-1-ol?
The IUPAC name of 1-(3-bromo-[1,2]selenazolo[2,3-a]pyridin-8-ium-2-yl)cyclohexan-1-ol (CID 132917684) is 1-(3-bromo-[1,2]selenazolo[2,3-a]pyridin-8-ium-2-yl)cyclohexan-1-ol.
What is the SMILES notation for 1-(3-bromo-[1,2]selenazolo[2,3-a]pyridin-8-ium-2-yl)cyclohexan-1-ol?
The canonical SMILES for 1-(3-bromo-[1,2]selenazolo[2,3-a]pyridin-8-ium-2-yl)cyclohexan-1-ol is OC1(c2[se][n+]3ccccc3c2Br)CCCCC1.
What is the InChIKey of 1-(3-bromo-[1,2]selenazolo[2,3-a]pyridin-8-ium-2-yl)cyclohexan-1-ol?
The InChIKey is PCPATGCDBXEVGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrNOSe/c14-11-10-6-2-5-9-15(10)17-12(11)13(16)7-3-1-4-8-13/h2,5-6,9,16H,1,3-4,7-8H2/q+1.
What are the key properties of 1-(3-bromo-[1,2]selenazolo[2,3-a]pyridin-8-ium-2-yl)cyclohexan-1-ol?
1-(3-bromo-[1,2]selenazolo[2,3-a]pyridin-8-ium-2-yl)cyclohexan-1-ol has a molecular weight of 360.13 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromo-[1,2]selenazolo[2,3-a]pyridin-8-ium-2-yl)cyclohexan-1-ol is sourced from PubChem (CID 132917684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).