C23H45B3O6Si — CID 132917900
trimethyl-[1,2,2-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]silane (PubChem CID 132917900) has the molecular formula C23H45B3O6Si and a molecular weight of 478.13 g/mol. Its IUPAC name is trimethyl-[1,2,2-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]silane.
| Compound Name | trimethyl-[1,2,2-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]silane |
|---|---|
| PubChem CID | 132917900 |
| Molecular Formula | C23H45B3O6Si |
| Molecular Weight | 478.13 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | trimethyl-[1,2,2-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]silane |
| SMILES | CC1(C)OB(C(B2OC(C)(C)C(C)(C)O2)=C(B2OC(C)(C)C(C)(C)O2)[Si](C)(C)C)OC1(C)C |
| InChI | InChI=1S/C23H45B3O6Si/c1-18(2)19(3,4)28-24(27-18)16(25-29-20(5,6)21(7,8)30-25)17(33(13,14)15)26-31-22(9,10)23(11,12)32-26/h1-15H3 |
| InChIKey | BMWFQWAFBRSDRD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.13 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|