C21H28O2 — CID 132918690
(3S,3aS,5aS,6R,8aS,8bS)-3-acetyl-3',3a-dimethylspiro[1,2,3,4,5,5a,7,8,8a,8b-decahydro-as-indacene-6,4'-cyclohexa-2,5-diene]-1'-one (PubChem CID 132918690) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is (3S,3aS,5aS,6R,8aS,8bS)-3-acetyl-3',3a-dimethylspiro[1,2,3,4,5,5a,7,8,8a,8b-decahydro-as-indacene-6,4'-cyclohexa-2,5-diene]-1'-one.
| Compound Name | (3S,3aS,5aS,6R,8aS,8bS)-3-acetyl-3',3a-dimethylspiro[1,2,3,4,5,5a,7,8,8a,8b-decahydro-as-indacene-6,4'-cyclohexa-2,5-diene]-1'-one |
|---|---|
| PubChem CID | 132918690 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | (3S,3aS,5aS,6R,8aS,8bS)-3-acetyl-3',3a-dimethylspiro[1,2,3,4,5,5a,7,8,8a,8b-decahydro-as-indacene-6,4'-cyclohexa-2,5-diene]-1'-one |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@]4(C=CC(=O)C=C4C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H28O2/c1-13-12-15(23)6-10-21(13)11-7-16-18-5-4-17(14(2)22)20(18,3)9-8-19(16)21/h6,10,12,16-19H,4-5,7-9,11H2,1-3H3/t16-,17+,18-,19-,20+,21+/m0/s1 |
| InChIKey | NGSFZYRBMZMBTR-NXMWLWCLSA-N |
| XLogP | 4.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |