C18H30O5 — CID 132918702
trans-ditert-butyl (3R,4S)-3-hydroxy-4-prop-1-en-2-ylcyclopentane-1,1-dicarboxylate (PubChem CID 132918702) has the molecular formula C18H30O5 and a molecular weight of 326.43 g/mol. Its IUPAC name is trans-ditert-butyl (3R,4S)-3-hydroxy-4-prop-1-en-2-ylcyclopentane-1,1-dicarboxylate.
| Compound Name | trans-ditert-butyl (3R,4S)-3-hydroxy-4-prop-1-en-2-ylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 132918702 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | trans-ditert-butyl (3R,4S)-3-hydroxy-4-prop-1-en-2-ylcyclopentane-1,1-dicarboxylate |
| SMILES | C=C(C)[C@@H]1CC(C(=O)OC(C)(C)C)(C(=O)OC(C)(C)C)C[C@H]1O |
| InChI | InChI=1S/C18H30O5/c1-11(2)12-9-18(10-13(12)19,14(20)22-16(3,4)5)15(21)23-17(6,7)8/h12-13,19H,1,9-10H2,2-8H3/t12-,13+/m0/s1 |
| InChIKey | MTLRPKGXRMNSNR-QWHCGFSZSA-N |
| XLogP | 3.00 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|