C20H27NO6 — CID 132918827
diethyl (4aS,7aS)-7-(4-methoxyphenyl)-2,3,4,4a,5,7a-hexahydropyrano[2,3-b]pyrrole-6,6-dicarboxylate (PubChem CID 132918827) has the molecular formula C20H27NO6 and a molecular weight of 377.44 g/mol. Its IUPAC name is diethyl (4aS,7aS)-7-(4-methoxyphenyl)-2,3,4,4a,5,7a-hexahydropyrano[2,3-b]pyrrole-6,6-dicarboxylate.
| Compound Name | diethyl (4aS,7aS)-7-(4-methoxyphenyl)-2,3,4,4a,5,7a-hexahydropyrano[2,3-b]pyrrole-6,6-dicarboxylate |
|---|---|
| PubChem CID | 132918827 |
| Molecular Formula | C20H27NO6 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | diethyl (4aS,7aS)-7-(4-methoxyphenyl)-2,3,4,4a,5,7a-hexahydropyrano[2,3-b]pyrrole-6,6-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H]2CCCO[C@@H]2N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H27NO6/c1-4-25-18(22)20(19(23)26-5-2)13-14-7-6-12-27-17(14)21(20)15-8-10-16(24-3)11-9-15/h8-11,14,17H,4-7,12-13H2,1-3H3/t14-,17-/m0/s1 |
| InChIKey | VQGOMFOVDIWGKM-YOEHRIQHSA-N |
| XLogP | 2.52 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|