C24H12F4 — CID 132918883
(4aZ,8aZ,12aZ,16aZ)-2,7,10,15-tetrafluorotetraphenylene (PubChem CID 132918883) has the molecular formula C24H12F4 and a molecular weight of 376.35 g/mol. Its IUPAC name is (4aZ,8aZ,12aZ,16aZ)-2,7,10,15-tetrafluorotetraphenylene.
| Compound Name | (4aZ,8aZ,12aZ,16aZ)-2,7,10,15-tetrafluorotetraphenylene |
|---|---|
| PubChem CID | 132918883 |
| Molecular Formula | C24H12F4 |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | (4aZ,8aZ,12aZ,16aZ)-2,7,10,15-tetrafluorotetraphenylene |
| SMILES | Fc1ccc2/c(c1)=c1/cc(F)cc/c1=c1\ccc(F)c\c1=c1/cc(F)cc/c1=2 |
| InChI | InChI=1S/C24H12F4/c25-13-1-5-17-18-6-2-14(26)10-22(18)24-12-16(28)4-8-20(24)19-7-3-15(27)11-23(19)21(17)9-13/h1-12H/b18-17-,20-19-,23-21-,24-22- |
| InChIKey | FYMKDBNHLGNYBC-PVLWAFRASA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |