C37H36N2O2 — CID 132919020
9-[(1-methoxy-9H-carbazol-3-yl)methyl]-3,5-dimethyl-3-(4-methylpent-3-enyl)-11H-pyrano[3,2-a]carbazole (PubChem CID 132919020) has the molecular formula C37H36N2O2 and a molecular weight of 540.71 g/mol. Its IUPAC name is 9-[(1-methoxy-9H-carbazol-3-yl)methyl]-3,5-dimethyl-3-(4-methylpent-3-enyl)-11H-pyrano[3,2-a]carbazole.
| Compound Name | 9-[(1-methoxy-9H-carbazol-3-yl)methyl]-3,5-dimethyl-3-(4-methylpent-3-enyl)-11H-pyrano[3,2-a]carbazole |
|---|---|
| PubChem CID | 132919020 |
| Molecular Formula | C37H36N2O2 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | 9-[(1-methoxy-9H-carbazol-3-yl)methyl]-3,5-dimethyl-3-(4-methylpent-3-enyl)-11H-pyrano[3,2-a]carbazole |
| SMILES | COc1cc(Cc2ccc3c(c2)[nH]c2c4c(c(C)cc23)OC(C)(CCC=C(C)C)C=C4)cc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C37H36N2O2/c1-22(2)9-8-15-37(4)16-14-28-34-29(17-23(3)36(28)41-37)27-13-12-24(20-32(27)39-34)18-25-19-30-26-10-6-7-11-31(26)38-35(30)33(21-25)40-5/h6-7,9-14,16-17,19-21,38-39H,8,15,18H2,1-5H3 |
| InChIKey | NWCWURSHTXVCNI-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 50.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|