C26H52O7Si2 — CID 132919255
[(3aS,4R,6S,6aR)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethenyl-6-(methoxymethoxymethyl)-2,2-dimethyl-4,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 132919255) has the molecular formula C26H52O7Si2 and a molecular weight of 532.87 g/mol. Its IUPAC name is [(3aS,4R,6S,6aR)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethenyl-6-(methoxymethoxymethyl)-2,2-dimethyl-4,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aS,4R,6S,6aR)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethenyl-6-(methoxymethoxymethyl)-2,2-dimethyl-4,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 132919255 |
| Molecular Formula | C26H52O7Si2 |
| Molecular Weight | 532.87 g/mol |
| Exact Mass | 532.33 |
| IUPAC Name | [(3aS,4R,6S,6aR)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethenyl-6-(methoxymethoxymethyl)-2,2-dimethyl-4,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=C[C@H]1O[C@@](COCOC)(CO[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@]21CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H52O7Si2/c1-15-20-26(18-30-35(13,14)23(5,6)7)21(32-24(8,9)33-26)25(31-20,16-28-19-27-10)17-29-34(11,12)22(2,3)4/h15,20-21H,1,16-19H2,2-14H3/t20-,21-,25+,26+/m1/s1 |
| InChIKey | WRUWXUVYQCFEOT-VCPRHENPSA-N |
| XLogP | 5.86 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.87 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|