C17H27NO — CID 132919282
(1R,4R)-N-tert-butyl-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide (PubChem CID 132919282) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is (1R,4R)-N-tert-butyl-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide.
| Compound Name | (1R,4R)-N-tert-butyl-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide |
|---|---|
| PubChem CID | 132919282 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | (1R,4R)-N-tert-butyl-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxamide |
| SMILES | CC1=C[C@@H]2C(C(=O)NC(C)(C)C)=C[C@H]1CC2C(C)C |
| InChI | InChI=1S/C17H27NO/c1-10(2)13-8-12-9-15(14(13)7-11(12)3)16(19)18-17(4,5)6/h7,9-10,12-14H,8H2,1-6H3,(H,18,19)/t12-,13?,14+/m1/s1 |
| InChIKey | PQNZZZWUUQDRHL-YIOYIWSBSA-N |
| XLogP | 3.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|