C16H14IN3O3 — CID 13292081
9-(3-iodoanilino)-6-methyl-4-oxo-6,7-dihydropyrido[1,2-a]pyrimidine-3-carboxylic acid (PubChem CID 13292081) has the molecular formula C16H14IN3O3 and a molecular weight of 423.21 g/mol. Its IUPAC name is 9-(3-iodoanilino)-6-methyl-4-oxo-6,7-dihydropyrido[1,2-a]pyrimidine-3-carboxylic acid.
| Compound Name | 9-(3-iodoanilino)-6-methyl-4-oxo-6,7-dihydropyrido[1,2-a]pyrimidine-3-carboxylic acid |
|---|---|
| PubChem CID | 13292081 |
| Molecular Formula | C16H14IN3O3 |
| Molecular Weight | 423.21 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | 9-(3-iodoanilino)-6-methyl-4-oxo-6,7-dihydropyrido[1,2-a]pyrimidine-3-carboxylic acid |
| SMILES | CC1CC=C(Nc2cccc(I)c2)c2ncc(C(=O)O)c(=O)n21 |
| InChI | InChI=1S/C16H14IN3O3/c1-9-5-6-13(19-11-4-2-3-10(17)7-11)14-18-8-12(16(22)23)15(21)20(9)14/h2-4,6-9,19H,5H2,1H3,(H,22,23) |
| InChIKey | MWFKPURYNJHORE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.21 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|