About [4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenyl]-triethylsilane
[4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenyl]-triethylsilane (PubChem CID 13292181) has the molecular formula C22H39NOSi
and a molecular weight of 361.65 g/mol. Its IUPAC name is [4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenyl]-triethylsilane.
Molecular Properties
| Compound Name | [4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenyl]-triethylsilane |
| PubChem CID | 13292181 |
| Molecular Formula | C22H39NOSi |
| Molecular Weight | 361.65 g/mol |
| Exact Mass | 361.28 |
| IUPAC Name | [4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenyl]-triethylsilane |
| SMILES | CC[Si](CC)(CC)c1ccc(CC(C)CN2CC(C)OC(C)C2)cc1 |
| InChI | InChI=1S/C22H39NOSi/c1-7-25(8-2,9-3)22-12-10-21(11-13-22)14-18(4)15-23-16-19(5)24-20(6)17-23/h10-13,18-20H,7-9,14-17H2,1-6H3 |
| InChIKey | BELXDEDRRKWLRJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.65 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenyl]-triethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenyl]-triethylsilane?
The IUPAC name of [4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenyl]-triethylsilane (CID 13292181) is [4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenyl]-triethylsilane.
What is the SMILES notation for [4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenyl]-triethylsilane?
The canonical SMILES for [4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenyl]-triethylsilane is CC[Si](CC)(CC)c1ccc(CC(C)CN2CC(C)OC(C)C2)cc1.
What is the InChIKey of [4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenyl]-triethylsilane?
The InChIKey is BELXDEDRRKWLRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H39NOSi/c1-7-25(8-2,9-3)22-12-10-21(11-13-22)14-18(4)15-23-16-19(5)24-20(6)17-23/h10-13,18-20H,7-9,14-17H2,1-6H3.
What are the key properties of [4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenyl]-triethylsilane?
[4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenyl]-triethylsilane has a molecular weight of 361.65 g/mol, XLogP of 4.69, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]phenyl]-triethylsilane is sourced from PubChem (CID 13292181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).