C19H33NOSi — CID 13292188
[4-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-methylpropyl]phenyl]-trimethylsilane (PubChem CID 13292188) has the molecular formula C19H33NOSi and a molecular weight of 319.57 g/mol. Its IUPAC name is [4-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-methylpropyl]phenyl]-trimethylsilane.
| Compound Name | [4-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-methylpropyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 13292188 |
| Molecular Formula | C19H33NOSi |
| Molecular Weight | 319.57 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | [4-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-methylpropyl]phenyl]-trimethylsilane |
| SMILES | CC(Cc1ccc([Si](C)(C)C)cc1)CN1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C19H33NOSi/c1-15(12-20-13-16(2)21-17(3)14-20)11-18-7-9-19(10-8-18)22(4,5)6/h7-10,15-17H,11-14H2,1-6H3/t15?,16-,17+ |
| InChIKey | XUJVGYPOIKHHTK-ALOPSCKCSA-N |
| XLogP | 3.52 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|