C17H16N4O — CID 13292301
1,5-bis(3-methylphenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 13292301) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 1,5-bis(3-methylphenyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 1,5-bis(3-methylphenyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 13292301 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 1,5-bis(3-methylphenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1cccc(-c2nc(C(N)=O)nn2-c2cccc(C)c2)c1 |
| InChI | InChI=1S/C17H16N4O/c1-11-5-3-7-13(9-11)17-19-16(15(18)22)20-21(17)14-8-4-6-12(2)10-14/h3-10H,1-2H3,(H2,18,22) |
| InChIKey | DCUDDRNAGVIJQO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |