About 4-(pentylamino)butanoic acid
4-(pentylamino)butanoic acid (PubChem CID 13292338) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is 4-(pentylamino)butanoic acid.
Molecular Properties
| Compound Name | 4-(pentylamino)butanoic acid |
| PubChem CID | 13292338 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 4-(pentylamino)butanoic acid |
| SMILES | CCCCCNCCCC(=O)O |
| InChI | InChI=1S/C9H19NO2/c1-2-3-4-7-10-8-5-6-9(11)12/h10H,2-8H2,1H3,(H,11,12) |
| InChIKey | SVWNYTZMQCVJAY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(pentylamino)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(pentylamino)butanoic acid?
The IUPAC name of 4-(pentylamino)butanoic acid (CID 13292338) is 4-(pentylamino)butanoic acid.
What is the SMILES notation for 4-(pentylamino)butanoic acid?
The canonical SMILES for 4-(pentylamino)butanoic acid is CCCCCNCCCC(=O)O.
What is the InChIKey of 4-(pentylamino)butanoic acid?
The InChIKey is SVWNYTZMQCVJAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2/c1-2-3-4-7-10-8-5-6-9(11)12/h10H,2-8H2,1H3,(H,11,12).
What are the key properties of 4-(pentylamino)butanoic acid?
4-(pentylamino)butanoic acid has a molecular weight of 173.26 g/mol, XLogP of 1.63, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(pentylamino)butanoic acid is sourced from PubChem (CID 13292338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).