About N-(4-acetylphenyl)-2,3-dipyridin-2-ylquinoxaline-6-carboxamide
N-(4-acetylphenyl)-2,3-dipyridin-2-ylquinoxaline-6-carboxamide (PubChem CID 1329252) has the molecular formula C27H19N5O2
and a molecular weight of 445.48 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2,3-dipyridin-2-ylquinoxaline-6-carboxamide.
Molecular Properties
| Compound Name | N-(4-acetylphenyl)-2,3-dipyridin-2-ylquinoxaline-6-carboxamide |
| PubChem CID | 1329252 |
| Molecular Formula | C27H19N5O2 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | N-(4-acetylphenyl)-2,3-dipyridin-2-ylquinoxaline-6-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2ccc3nc(-c4ccccn4)c(-c4ccccn4)nc3c2)cc1 |
| InChI | InChI=1S/C27H19N5O2/c1-17(33)18-8-11-20(12-9-18)30-27(34)19-10-13-21-24(16-19)32-26(23-7-3-5-15-29-23)25(31-21)22-6-2-4-14-28-22/h2-16H,1H3,(H,30,34) |
| InChIKey | LAUOGLJQZHWFDA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 97.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(4-acetylphenyl)-2,3-dipyridin-2-ylquinoxaline-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-acetylphenyl)-2,3-dipyridin-2-ylquinoxaline-6-carboxamide?
The IUPAC name of N-(4-acetylphenyl)-2,3-dipyridin-2-ylquinoxaline-6-carboxamide (CID 1329252) is N-(4-acetylphenyl)-2,3-dipyridin-2-ylquinoxaline-6-carboxamide.
What is the SMILES notation for N-(4-acetylphenyl)-2,3-dipyridin-2-ylquinoxaline-6-carboxamide?
The canonical SMILES for N-(4-acetylphenyl)-2,3-dipyridin-2-ylquinoxaline-6-carboxamide is CC(=O)c1ccc(NC(=O)c2ccc3nc(-c4ccccn4)c(-c4ccccn4)nc3c2)cc1.
What is the InChIKey of N-(4-acetylphenyl)-2,3-dipyridin-2-ylquinoxaline-6-carboxamide?
The InChIKey is LAUOGLJQZHWFDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H19N5O2/c1-17(33)18-8-11-20(12-9-18)30-27(34)19-10-13-21-24(16-19)32-26(23-7-3-5-15-29-23)25(31-21)22-6-2-4-14-28-22/h2-16H,1H3,(H,30,34).
What are the key properties of N-(4-acetylphenyl)-2,3-dipyridin-2-ylquinoxaline-6-carboxamide?
N-(4-acetylphenyl)-2,3-dipyridin-2-ylquinoxaline-6-carboxamide has a molecular weight of 445.48 g/mol, XLogP of 5.21, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-acetylphenyl)-2,3-dipyridin-2-ylquinoxaline-6-carboxamide is sourced from PubChem (CID 1329252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).