C6H12N2 — CID 13292800
2,2-dimethylcyclopropane-1-carboximidamide (PubChem CID 13292800) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is 2,2-dimethylcyclopropane-1-carboximidamide.
| Compound Name | 2,2-dimethylcyclopropane-1-carboximidamide |
|---|---|
| PubChem CID | 13292800 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 2,2-dimethylcyclopropane-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1CC1(C)C |
| InChI | InChI=1S/C6H12N2/c1-6(2)3-4(6)5(7)8/h4H,3H2,1-2H3,(H3,7,8) |
| InChIKey | GOZCTJIUMDNFPH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|