About 3-[(2S)-1,3-dimethylpyrrolidin-2-yl]pyridine
3-[(2S)-1,3-dimethylpyrrolidin-2-yl]pyridine (PubChem CID 13292847) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 3-[(2S)-1,3-dimethylpyrrolidin-2-yl]pyridine.
Molecular Properties
| Compound Name | 3-[(2S)-1,3-dimethylpyrrolidin-2-yl]pyridine |
| PubChem CID | 13292847 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 3-[(2S)-1,3-dimethylpyrrolidin-2-yl]pyridine |
| SMILES | CC1CCN(C)[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C11H16N2/c1-9-5-7-13(2)11(9)10-4-3-6-12-8-10/h3-4,6,8-9,11H,5,7H2,1-2H3/t9?,11-/m0/s1 |
| InChIKey | RDIIPHAJALUDTE-UMJHXOGRSA-N |
| XLogP | 2.09 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(2S)-1,3-dimethylpyrrolidin-2-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S)-1,3-dimethylpyrrolidin-2-yl]pyridine?
The IUPAC name of 3-[(2S)-1,3-dimethylpyrrolidin-2-yl]pyridine (CID 13292847) is 3-[(2S)-1,3-dimethylpyrrolidin-2-yl]pyridine.
What is the SMILES notation for 3-[(2S)-1,3-dimethylpyrrolidin-2-yl]pyridine?
The canonical SMILES for 3-[(2S)-1,3-dimethylpyrrolidin-2-yl]pyridine is CC1CCN(C)[C@@H]1c1cccnc1.
What is the InChIKey of 3-[(2S)-1,3-dimethylpyrrolidin-2-yl]pyridine?
The InChIKey is RDIIPHAJALUDTE-UMJHXOGRSA-N. The full InChI is InChI=1S/C11H16N2/c1-9-5-7-13(2)11(9)10-4-3-6-12-8-10/h3-4,6,8-9,11H,5,7H2,1-2H3/t9?,11-/m0/s1.
What are the key properties of 3-[(2S)-1,3-dimethylpyrrolidin-2-yl]pyridine?
3-[(2S)-1,3-dimethylpyrrolidin-2-yl]pyridine has a molecular weight of 176.26 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S)-1,3-dimethylpyrrolidin-2-yl]pyridine is sourced from PubChem (CID 13292847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).