C35H49F3O9SSi — CID 132933345
[(1R,3S,5S,7R,9S,10S,12R,13S)-9-phenylmethoxy-5-(2-phenylmethoxyethyl)-13-triethylsilyloxy-2,6,11-trioxatricyclo[8.4.0.03,7]tetradecan-12-yl]methyl trifluoromethanesulfonate (PubChem CID 132933345) has the molecular formula C35H49F3O9SSi and a molecular weight of 730.92 g/mol. Its IUPAC name is [(1R,3S,5S,7R,9S,10S,12R,13S)-9-phenylmethoxy-5-(2-phenylmethoxyethyl)-13-triethylsilyloxy-2,6,11-trioxatricyclo[8.4.0.03,7]tetradecan-12-yl]methyl trifluoromethanesulfonate.
| Compound Name | [(1R,3S,5S,7R,9S,10S,12R,13S)-9-phenylmethoxy-5-(2-phenylmethoxyethyl)-13-triethylsilyloxy-2,6,11-trioxatricyclo[8.4.0.03,7]tetradecan-12-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 132933345 |
| Molecular Formula | C35H49F3O9SSi |
| Molecular Weight | 730.92 g/mol |
| Exact Mass | 730.28 |
| IUPAC Name | [(1R,3S,5S,7R,9S,10S,12R,13S)-9-phenylmethoxy-5-(2-phenylmethoxyethyl)-13-triethylsilyloxy-2,6,11-trioxatricyclo[8.4.0.03,7]tetradecan-12-yl]methyl trifluoromethanesulfonate |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@H]2O[C@H]3C[C@H](CCOCc4ccccc4)O[C@@H]3C[C@H](OCc3ccccc3)[C@@H]2O[C@@H]1COS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C35H49F3O9SSi/c1-4-49(5-2,6-3)47-30-21-32-34(46-33(30)24-43-48(39,40)35(36,37)38)31(42-23-26-15-11-8-12-16-26)20-29-28(45-32)19-27(44-29)17-18-41-22-25-13-9-7-10-14-25/h7-16,27-34H,4-6,17-24H2,1-3H3/t27-,28-,29+,30-,31-,32+,33+,34-/m0/s1 |
| InChIKey | CTIJARHHPFPNAT-LNPCCJLYSA-N |
| XLogP | 6.91 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.92 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|