About 1,8-dibromo-3,6-bis(4-tert-butylphenyl)pyrene
1,8-dibromo-3,6-bis(4-tert-butylphenyl)pyrene (PubChem CID 132933834) has the molecular formula C36H32Br2
and a molecular weight of 624.46 g/mol. Its IUPAC name is 1,8-dibromo-3,6-bis(4-tert-butylphenyl)pyrene.
Molecular Properties
| Compound Name | 1,8-dibromo-3,6-bis(4-tert-butylphenyl)pyrene |
| PubChem CID | 132933834 |
| Molecular Formula | C36H32Br2 |
| Molecular Weight | 624.46 g/mol |
| Exact Mass | 622.09 |
| IUPAC Name | 1,8-dibromo-3,6-bis(4-tert-butylphenyl)pyrene |
| SMILES | CC(C)(C)c1ccc(-c2cc(Br)c3ccc4c(Br)cc(-c5ccc(C(C)(C)C)cc5)c5ccc2c3c45)cc1 |
| InChI | InChI=1S/C36H32Br2/c1-35(2,3)23-11-7-21(8-12-23)29-19-31(37)27-17-18-28-32(38)20-30(26-16-15-25(29)33(27)34(26)28)22-9-13-24(14-10-22)36(4,5)6/h7-20H,1-6H3 |
| InChIKey | PBSQFGPEJSMJPA-UHFFFAOYSA-N |
| XLogP | 12.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 624.46 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1,8-dibromo-3,6-bis(4-tert-butylphenyl)pyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-dibromo-3,6-bis(4-tert-butylphenyl)pyrene?
The IUPAC name of 1,8-dibromo-3,6-bis(4-tert-butylphenyl)pyrene (CID 132933834) is 1,8-dibromo-3,6-bis(4-tert-butylphenyl)pyrene.
What is the SMILES notation for 1,8-dibromo-3,6-bis(4-tert-butylphenyl)pyrene?
The canonical SMILES for 1,8-dibromo-3,6-bis(4-tert-butylphenyl)pyrene is CC(C)(C)c1ccc(-c2cc(Br)c3ccc4c(Br)cc(-c5ccc(C(C)(C)C)cc5)c5ccc2c3c45)cc1.
What is the InChIKey of 1,8-dibromo-3,6-bis(4-tert-butylphenyl)pyrene?
The InChIKey is PBSQFGPEJSMJPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H32Br2/c1-35(2,3)23-11-7-21(8-12-23)29-19-31(37)27-17-18-28-32(38)20-30(26-16-15-25(29)33(27)34(26)28)22-9-13-24(14-10-22)36(4,5)6/h7-20H,1-6H3.
What are the key properties of 1,8-dibromo-3,6-bis(4-tert-butylphenyl)pyrene?
1,8-dibromo-3,6-bis(4-tert-butylphenyl)pyrene has a molecular weight of 624.46 g/mol, XLogP of 12.04, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-dibromo-3,6-bis(4-tert-butylphenyl)pyrene is sourced from PubChem (CID 132933834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).