C23H36O5 — CID 132934366
(1R,3S,5S,6aS,7R,8R,10S)-1,3,10-trimethoxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-ol (PubChem CID 132934366) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is (1R,3S,5S,6aS,7R,8R,10S)-1,3,10-trimethoxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-ol.
| Compound Name | (1R,3S,5S,6aS,7R,8R,10S)-1,3,10-trimethoxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-ol |
|---|---|
| PubChem CID | 132934366 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | (1R,3S,5S,6aS,7R,8R,10S)-1,3,10-trimethoxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-ol |
| SMILES | C=CC(=C)CC[C@@]1(C)C2C[C@H](O)C=C3[C@@H](OC)O[C@@H](OC)C32[C@@H](OC)C[C@H]1C |
| InChI | InChI=1S/C23H36O5/c1-8-14(2)9-10-22(4)15(3)11-19(25-5)23-17(12-16(24)13-18(22)23)20(26-6)28-21(23)27-7/h8,12,15-16,18-21,24H,1-2,9-11,13H2,3-7H3/t15-,16-,18?,19+,20+,21-,22-,23?/m1/s1 |
| InChIKey | KUSFVCHTPOSQLS-WOFBDBOYSA-N |
| XLogP | 3.84 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|