C30H41ClN4O3S — CID 132934659
1-N-benzyl-4-N-(7-chloroquinolin-4-yl)-1-N-[2-(2-piperidin-1-ylsulfonylethoxy)ethyl]pentane-1,4-diamine (PubChem CID 132934659) has the molecular formula C30H41ClN4O3S and a molecular weight of 573.20 g/mol. Its IUPAC name is 1-N-benzyl-4-N-(7-chloroquinolin-4-yl)-1-N-[2-(2-piperidin-1-ylsulfonylethoxy)ethyl]pentane-1,4-diamine.
| Compound Name | 1-N-benzyl-4-N-(7-chloroquinolin-4-yl)-1-N-[2-(2-piperidin-1-ylsulfonylethoxy)ethyl]pentane-1,4-diamine |
|---|---|
| PubChem CID | 132934659 |
| Molecular Formula | C30H41ClN4O3S |
| Molecular Weight | 573.20 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | 1-N-benzyl-4-N-(7-chloroquinolin-4-yl)-1-N-[2-(2-piperidin-1-ylsulfonylethoxy)ethyl]pentane-1,4-diamine |
| SMILES | CC(CCCN(CCOCCS(=O)(=O)N1CCCCC1)Cc1ccccc1)Nc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C30H41ClN4O3S/c1-25(33-29-14-15-32-30-23-27(31)12-13-28(29)30)9-8-16-34(24-26-10-4-2-5-11-26)19-20-38-21-22-39(36,37)35-17-6-3-7-18-35/h2,4-5,10-15,23,25H,3,6-9,16-22,24H2,1H3,(H,32,33) |
| InChIKey | RXIXZWGRVOYCGR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.20 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|