C30H13F9N2O — CID 132934792
2,2,2-trifluoro-1-[17-phenyl-10,19-bis(trifluoromethyl)-3,16-diazapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1(14),2,4,6,8,10,12,15(20),16,18,21-undecaen-13-yl]ethanone (PubChem CID 132934792) has the molecular formula C30H13F9N2O and a molecular weight of 588.43 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[17-phenyl-10,19-bis(trifluoromethyl)-3,16-diazapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1(14),2,4,6,8,10,12,15(20),16,18,21-undecaen-13-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[17-phenyl-10,19-bis(trifluoromethyl)-3,16-diazapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1(14),2,4,6,8,10,12,15(20),16,18,21-undecaen-13-yl]ethanone |
|---|---|
| PubChem CID | 132934792 |
| Molecular Formula | C30H13F9N2O |
| Molecular Weight | 588.43 g/mol |
| Exact Mass | 588.09 |
| IUPAC Name | 2,2,2-trifluoro-1-[17-phenyl-10,19-bis(trifluoromethyl)-3,16-diazapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1(14),2,4,6,8,10,12,15(20),16,18,21-undecaen-13-yl]ethanone |
| SMILES | O=C(c1cc2c(C(F)(F)F)c3ccccc3nc2c2ccc3c(C(F)(F)F)cc(-c4ccccc4)nc3c12)C(F)(F)F |
| InChI | InChI=1S/C30H13F9N2O/c31-28(32,33)20-13-22(14-6-2-1-3-7-14)41-26-15(20)10-11-17-23(26)18(27(42)30(37,38)39)12-19-24(29(34,35)36)16-8-4-5-9-21(16)40-25(17)19/h1-13H |
| InChIKey | ULRBCFFEZUQKMH-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.43 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|