C10H22O — CID 132935619
10,10,10-trideuteriodecan-1-ol (PubChem CID 132935619) has the molecular formula C10H22O and a molecular weight of 161.30 g/mol. Its IUPAC name is 10,10,10-trideuteriodecan-1-ol.
| Compound Name | 10,10,10-trideuteriodecan-1-ol |
|---|---|
| PubChem CID | 132935619 |
| Molecular Formula | C10H22O |
| Molecular Weight | 161.30 g/mol |
| Exact Mass | 161.19 |
| IUPAC Name | 10,10,10-trideuteriodecan-1-ol |
| SMILES | [2H]C([2H])([2H])CCCCCCCCCO |
| InChI | InChI=1S/C10H22O/c1-2-3-4-5-6-7-8-9-10-11/h11H,2-10H2,1H3/i1D3 |
| InChIKey | MWKFXSUHUHTGQN-FIBGUPNXSA-N |
| XLogP | 3.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|