About 2-hydroxyoct-7-en-4-one
2-hydroxyoct-7-en-4-one (PubChem CID 13293599) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 2-hydroxyoct-7-en-4-one.
Molecular Properties
| Compound Name | 2-hydroxyoct-7-en-4-one |
| PubChem CID | 13293599 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 2-hydroxyoct-7-en-4-one |
| SMILES | C=CCCC(=O)CC(C)O |
| InChI | InChI=1S/C8H14O2/c1-3-4-5-8(10)6-7(2)9/h3,7,9H,1,4-6H2,2H3 |
| InChIKey | GBAWHEJTJQXQEZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyoct-7-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyoct-7-en-4-one?
The IUPAC name of 2-hydroxyoct-7-en-4-one (CID 13293599) is 2-hydroxyoct-7-en-4-one.
What is the SMILES notation for 2-hydroxyoct-7-en-4-one?
The canonical SMILES for 2-hydroxyoct-7-en-4-one is C=CCCC(=O)CC(C)O.
What is the InChIKey of 2-hydroxyoct-7-en-4-one?
The InChIKey is GBAWHEJTJQXQEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-3-4-5-8(10)6-7(2)9/h3,7,9H,1,4-6H2,2H3.
What are the key properties of 2-hydroxyoct-7-en-4-one?
2-hydroxyoct-7-en-4-one has a molecular weight of 142.20 g/mol, XLogP of 1.29, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyoct-7-en-4-one is sourced from PubChem (CID 13293599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).