About 6-acetyl-2,3,4,5-tetrahydroazepine-1-carbaldehyde
6-acetyl-2,3,4,5-tetrahydroazepine-1-carbaldehyde (PubChem CID 13293771) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is 6-acetyl-2,3,4,5-tetrahydroazepine-1-carbaldehyde.
Molecular Properties
| Compound Name | 6-acetyl-2,3,4,5-tetrahydroazepine-1-carbaldehyde |
| PubChem CID | 13293771 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 6-acetyl-2,3,4,5-tetrahydroazepine-1-carbaldehyde |
| SMILES | CC(=O)C1=CN(C=O)CCCC1 |
| InChI | InChI=1S/C9H13NO2/c1-8(12)9-4-2-3-5-10(6-9)7-11/h6-7H,2-5H2,1H3 |
| InChIKey | KPAWJVFFFHNUOV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-acetyl-2,3,4,5-tetrahydroazepine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-acetyl-2,3,4,5-tetrahydroazepine-1-carbaldehyde?
The IUPAC name of 6-acetyl-2,3,4,5-tetrahydroazepine-1-carbaldehyde (CID 13293771) is 6-acetyl-2,3,4,5-tetrahydroazepine-1-carbaldehyde.
What is the SMILES notation for 6-acetyl-2,3,4,5-tetrahydroazepine-1-carbaldehyde?
The canonical SMILES for 6-acetyl-2,3,4,5-tetrahydroazepine-1-carbaldehyde is CC(=O)C1=CN(C=O)CCCC1.
What is the InChIKey of 6-acetyl-2,3,4,5-tetrahydroazepine-1-carbaldehyde?
The InChIKey is KPAWJVFFFHNUOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c1-8(12)9-4-2-3-5-10(6-9)7-11/h6-7H,2-5H2,1H3.
What are the key properties of 6-acetyl-2,3,4,5-tetrahydroazepine-1-carbaldehyde?
6-acetyl-2,3,4,5-tetrahydroazepine-1-carbaldehyde has a molecular weight of 167.21 g/mol, XLogP of 1.10, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-acetyl-2,3,4,5-tetrahydroazepine-1-carbaldehyde is sourced from PubChem (CID 13293771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).