C21H24O6 — CID 132937868
(5S,8R)-8-ethyl-5-(4-hydroxy-5,6-dimethyl-2-oxopyran-3-yl)-2,3,8-trimethyl-5,6-dihydrochromene-4,7-dione (PubChem CID 132937868) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is (5S,8R)-8-ethyl-5-(4-hydroxy-5,6-dimethyl-2-oxopyran-3-yl)-2,3,8-trimethyl-5,6-dihydrochromene-4,7-dione.
| Compound Name | (5S,8R)-8-ethyl-5-(4-hydroxy-5,6-dimethyl-2-oxopyran-3-yl)-2,3,8-trimethyl-5,6-dihydrochromene-4,7-dione |
|---|---|
| PubChem CID | 132937868 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (5S,8R)-8-ethyl-5-(4-hydroxy-5,6-dimethyl-2-oxopyran-3-yl)-2,3,8-trimethyl-5,6-dihydrochromene-4,7-dione |
| SMILES | CC[C@@]1(C)C(=O)C[C@H](c2c(O)c(C)c(C)oc2=O)c2c1oc(C)c(C)c2=O |
| InChI | InChI=1S/C21H24O6/c1-7-21(6)14(22)8-13(15-17(23)9(2)11(4)26-19(15)21)16-18(24)10(3)12(5)27-20(16)25/h13,24H,7-8H2,1-6H3/t13-,21-/m0/s1 |
| InChIKey | IQOQYVAMVLWEDE-ZSEKCTLFSA-N |
| XLogP | 3.30 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |