C19H30O9S2 — CID 132938151
[(3R,5R,8S,9S,10S,11S,13S,14S)-10,13-dimethyl-17-oxo-3-sulfooxy-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-11-yl] hydrogen sulfate (PubChem CID 132938151) has the molecular formula C19H30O9S2 and a molecular weight of 466.57 g/mol. Its IUPAC name is [(3R,5R,8S,9S,10S,11S,13S,14S)-10,13-dimethyl-17-oxo-3-sulfooxy-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-11-yl] hydrogen sulfate.
| Compound Name | [(3R,5R,8S,9S,10S,11S,13S,14S)-10,13-dimethyl-17-oxo-3-sulfooxy-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-11-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 132938151 |
| Molecular Formula | C19H30O9S2 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | [(3R,5R,8S,9S,10S,11S,13S,14S)-10,13-dimethyl-17-oxo-3-sulfooxy-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-11-yl] hydrogen sulfate |
| SMILES | C[C@]12CC[C@@H](OS(=O)(=O)O)C[C@H]1CC[C@@H]1[C@@H]2[C@@H](OS(=O)(=O)O)C[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C19H30O9S2/c1-18-8-7-12(27-29(21,22)23)9-11(18)3-4-13-14-5-6-16(20)19(14,2)10-15(17(13)18)28-30(24,25)26/h11-15,17H,3-10H2,1-2H3,(H,21,22,23)(H,24,25,26)/t11-,12-,13+,14+,15+,17-,18+,19+/m1/s1 |
| InChIKey | QGCMSGIHDIXPAH-DLAZEALESA-N |
| XLogP | 2.58 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|