C20H32O — CID 132938173
(1S,4E,6E,10E,14S)-4,10,14-trimethyl-7-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-triene (PubChem CID 132938173) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is (1S,4E,6E,10E,14S)-4,10,14-trimethyl-7-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-triene.
| Compound Name | (1S,4E,6E,10E,14S)-4,10,14-trimethyl-7-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-triene |
|---|---|
| PubChem CID | 132938173 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (1S,4E,6E,10E,14S)-4,10,14-trimethyl-7-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-triene |
| SMILES | C/C1=C\CC[C@]2(C)O[C@H]2CC/C(C)=C/C=C(/C(C)C)CC1 |
| InChI | InChI=1S/C20H32O/c1-15(2)18-11-8-16(3)7-6-14-20(5)19(21-20)13-10-17(4)9-12-18/h7,9,12,15,19H,6,8,10-11,13-14H2,1-5H3/b16-7+,17-9+,18-12+/t19-,20-/m0/s1 |
| InChIKey | UIFUEZJMOQTFLI-AJYRKPNUSA-N |
| XLogP | 5.97 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|