C15H24O2 — CID 132938175
(1S,2S,4R,7S,8R,11S)-7,11-dimethyl-4-propan-2-yl-3,12-dioxatetracyclo[6.3.1.01,8.02,4]dodecane (PubChem CID 132938175) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (1S,2S,4R,7S,8R,11S)-7,11-dimethyl-4-propan-2-yl-3,12-dioxatetracyclo[6.3.1.01,8.02,4]dodecane.
| Compound Name | (1S,2S,4R,7S,8R,11S)-7,11-dimethyl-4-propan-2-yl-3,12-dioxatetracyclo[6.3.1.01,8.02,4]dodecane |
|---|---|
| PubChem CID | 132938175 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (1S,2S,4R,7S,8R,11S)-7,11-dimethyl-4-propan-2-yl-3,12-dioxatetracyclo[6.3.1.01,8.02,4]dodecane |
| SMILES | CC(C)[C@]12CC[C@H](C)[C@]34CC[C@H](C)[C@]3(O4)[C@H]1O2 |
| InChI | InChI=1S/C15H24O2/c1-9(2)13-7-5-10(3)14-8-6-11(4)15(14,17-14)12(13)16-13/h9-12H,5-8H2,1-4H3/t10-,11-,12-,13+,14+,15-/m0/s1 |
| InChIKey | WWJMBUFCDNYHOS-VMCMIOBHSA-N |
| XLogP | 3.15 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|