C20H16F2O4 — CID 132938405
(4Z,6Z)-4,6-bis[(4-fluorophenyl)methylidene]-2-methoxy-2-methyl-1,3-dioxan-5-one (PubChem CID 132938405) has the molecular formula C20H16F2O4 and a molecular weight of 358.34 g/mol. Its IUPAC name is (4Z,6Z)-4,6-bis[(4-fluorophenyl)methylidene]-2-methoxy-2-methyl-1,3-dioxan-5-one.
| Compound Name | (4Z,6Z)-4,6-bis[(4-fluorophenyl)methylidene]-2-methoxy-2-methyl-1,3-dioxan-5-one |
|---|---|
| PubChem CID | 132938405 |
| Molecular Formula | C20H16F2O4 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | (4Z,6Z)-4,6-bis[(4-fluorophenyl)methylidene]-2-methoxy-2-methyl-1,3-dioxan-5-one |
| SMILES | COC1(C)O/C(=C\c2ccc(F)cc2)C(=O)/C(=C/c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C20H16F2O4/c1-20(24-2)25-17(11-13-3-7-15(21)8-4-13)19(23)18(26-20)12-14-5-9-16(22)10-6-14/h3-12H,1-2H3/b17-11-,18-12- |
| InChIKey | SFLTYJBYXIJMDM-WHYMJUELSA-N |
| XLogP | 4.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|