About 6-bromo-4,4-dimethoxy-2,3-dimethylcyclohexa-2,5-dien-1-one
6-bromo-4,4-dimethoxy-2,3-dimethylcyclohexa-2,5-dien-1-one (PubChem CID 132938540) has the molecular formula C10H13BrO3
and a molecular weight of 261.11 g/mol. Its IUPAC name is 6-bromo-4,4-dimethoxy-2,3-dimethylcyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | 6-bromo-4,4-dimethoxy-2,3-dimethylcyclohexa-2,5-dien-1-one |
| PubChem CID | 132938540 |
| Molecular Formula | C10H13BrO3 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 6-bromo-4,4-dimethoxy-2,3-dimethylcyclohexa-2,5-dien-1-one |
| SMILES | COC1(OC)C=C(Br)C(=O)C(C)=C1C |
| InChI | InChI=1S/C10H13BrO3/c1-6-7(2)10(13-3,14-4)5-8(11)9(6)12/h5H,1-4H3 |
| InChIKey | MVQQMWAPBOFITG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-4,4-dimethoxy-2,3-dimethylcyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4,4-dimethoxy-2,3-dimethylcyclohexa-2,5-dien-1-one?
The IUPAC name of 6-bromo-4,4-dimethoxy-2,3-dimethylcyclohexa-2,5-dien-1-one (CID 132938540) is 6-bromo-4,4-dimethoxy-2,3-dimethylcyclohexa-2,5-dien-1-one.
What is the SMILES notation for 6-bromo-4,4-dimethoxy-2,3-dimethylcyclohexa-2,5-dien-1-one?
The canonical SMILES for 6-bromo-4,4-dimethoxy-2,3-dimethylcyclohexa-2,5-dien-1-one is COC1(OC)C=C(Br)C(=O)C(C)=C1C.
What is the InChIKey of 6-bromo-4,4-dimethoxy-2,3-dimethylcyclohexa-2,5-dien-1-one?
The InChIKey is MVQQMWAPBOFITG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrO3/c1-6-7(2)10(13-3,14-4)5-8(11)9(6)12/h5H,1-4H3.
What are the key properties of 6-bromo-4,4-dimethoxy-2,3-dimethylcyclohexa-2,5-dien-1-one?
6-bromo-4,4-dimethoxy-2,3-dimethylcyclohexa-2,5-dien-1-one has a molecular weight of 261.11 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4,4-dimethoxy-2,3-dimethylcyclohexa-2,5-dien-1-one is sourced from PubChem (CID 132938540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).