C18H19NO7 — CID 132938544
methyl (1R,6R,7R)-5,5-dimethoxy-3-methyl-1-(4-nitrophenyl)-2-oxobicyclo[4.1.0]hept-3-ene-7-carboxylate (PubChem CID 132938544) has the molecular formula C18H19NO7 and a molecular weight of 361.35 g/mol. Its IUPAC name is methyl (1R,6R,7R)-5,5-dimethoxy-3-methyl-1-(4-nitrophenyl)-2-oxobicyclo[4.1.0]hept-3-ene-7-carboxylate.
| Compound Name | methyl (1R,6R,7R)-5,5-dimethoxy-3-methyl-1-(4-nitrophenyl)-2-oxobicyclo[4.1.0]hept-3-ene-7-carboxylate |
|---|---|
| PubChem CID | 132938544 |
| Molecular Formula | C18H19NO7 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | methyl (1R,6R,7R)-5,5-dimethoxy-3-methyl-1-(4-nitrophenyl)-2-oxobicyclo[4.1.0]hept-3-ene-7-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2C(OC)(OC)C=C(C)C(=O)[C@@]12c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H19NO7/c1-10-9-17(25-3,26-4)14-13(16(21)24-2)18(14,15(10)20)11-5-7-12(8-6-11)19(22)23/h5-9,13-14H,1-4H3/t13-,14-,18-/m0/s1 |
| InChIKey | ZAUGMJRARTZDCG-DEYYWGMASA-N |
| XLogP | 1.77 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|