C18H38O3Si2 — CID 132938699
(Z,1S)-7-[tert-butyl(dimethyl)silyl]oxy-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]hept-3-en-1-ol (PubChem CID 132938699) has the molecular formula C18H38O3Si2 and a molecular weight of 358.67 g/mol. Its IUPAC name is (Z,1S)-7-[tert-butyl(dimethyl)silyl]oxy-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]hept-3-en-1-ol.
| Compound Name | (Z,1S)-7-[tert-butyl(dimethyl)silyl]oxy-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]hept-3-en-1-ol |
|---|---|
| PubChem CID | 132938699 |
| Molecular Formula | C18H38O3Si2 |
| Molecular Weight | 358.67 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | (Z,1S)-7-[tert-butyl(dimethyl)silyl]oxy-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]hept-3-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCCC/C=C\C[C@H](O)[C@@H]1O[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C18H38O3Si2/c1-18(2,3)23(7,8)20-14-12-10-9-11-13-15(19)16-17(21-16)22(4,5)6/h9,11,15-17,19H,10,12-14H2,1-8H3/b11-9-/t15-,16-,17-/m0/s1 |
| InChIKey | MVPXMTAKASKVGI-OCWZIBQQSA-N |
| XLogP | 4.74 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.67 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|